CAS 63503-98-0 is the registry number for Acetoacetanilide-4-sulfonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 1g.
Sodium 4-(3-oxobutanoylamino)benzenesulfonate (CAS 63503-98-0) is a chemical compound with the molecular formula C10H10NNaO5S and a molecular weight of 279.25 g/mol. IUPAC name: sodium 4-(3-oxobutanoylamino)benzenesulfonate. InChIKey: NOBCJZCJYXNHJB-UHFFFAOYSA-M.
| Molecular formula | C10H10NNaO5S |
|---|---|
| Molecular weight | 279.25 g/mol |
| IUPAC name | sodium 4-(3-oxobutanoylamino)benzenesulfonate |
| InChIKey | NOBCJZCJYXNHJB-UHFFFAOYSA-M |
| SMILES | CC(=O)CC(=O)NC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)