Products 63504-15-4
CAS 63504-15-4 is the registry number for LON 954. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-[1-amino-2-(2,6-dichlorophenyl)ethylidene]urea;hydrochloride (CAS 63504-15-4) is a chemical compound with the molecular formula C9H10Cl3N3O and a molecular weight of 282.5 g/mol. IUPAC name: (Z)-[1-amino-2-(2,6-dichlorophenyl)ethylidene]urea;hydrochloride. InChIKey: AIROWKHOMTWHBV-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N3O |
|---|---|
| Molecular weight | 282.5 g/mol |
| IUPAC name | (Z)-[1-amino-2-(2,6-dichlorophenyl)ethylidene]urea;hydrochloride |
| InChIKey | AIROWKHOMTWHBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C/C(=N/C(=O)N)/N)Cl.Cl |
Computed by PubChem (NCBI)