Products 63555-61-3
CAS 63555-61-3 is the registry number for 2'-F-CDP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 63555-61-3) is a chemical compound with the molecular formula C9H14FN3O10P2 and a molecular weight of 405.17 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: LRRKTHLVDWWAJG-XVFCMESISA-N.
| Molecular formula | C9H14FN3O10P2 |
|---|---|
| Molecular weight | 405.17 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | LRRKTHLVDWWAJG-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O)O)F |
Computed by PubChem (NCBI)