CAS 635702-49-7 is the registry number for N1,N3-Bis((R)-1-phenylethyl)propane-1,3-diamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine;dihydrochloride (CAS 635702-49-7) is a chemical compound with the molecular formula C19H28Cl2N2 and a molecular weight of 355.3 g/mol. IUPAC name: N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine;dihydrochloride. InChIKey: RPGXCUMDVBOHHH-QAPNYFPESA-N.
| Molecular formula | C19H28Cl2N2 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine;dihydrochloride |
| InChIKey | RPGXCUMDVBOHHH-QAPNYFPESA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCCCN[C@H](C)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)