Products 635705-72-5
CAS 635705-72-5 appears in our catalog under these names: Apremilast Impurity 11, Apremilast Impurity B (Deacetyl Apremilast), (S)-4-Amino-2-(1-(3-ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl)isoindoline-1,3-dione, 98%, Des-acetyl Apremilast, >95% (HPLC), Des-acetyl apremilast. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg.
4-amino-2-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione (CAS 635705-72-5) is a chemical compound with the molecular formula C20H22N2O6S and a molecular weight of 418.5 g/mol. IUPAC name: 4-amino-2-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione. InChIKey: BHJUWEUNUCJYER-OAHLLOKOSA-N.
| Molecular formula | C20H22N2O6S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 4-amino-2-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione |
| InChIKey | BHJUWEUNUCJYER-OAHLLOKOSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N2C(=O)C3=C(C2=O)C(=CC=C3)N)OC |
Computed by PubChem (NCBI)