Products 635725-16-5
CAS 635725-16-5 appears in our catalog under these names: p38 MAPK–IN–2, p38 MAPK-IN-2. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 20mg, Get quote.
1-[4-[3-(4-chloro-2-fluorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-hydroxyethanone (CAS 635725-16-5) is a chemical compound with the molecular formula C20H19ClFN5O2 and a molecular weight of 415.8 g/mol. IUPAC name: 1-[4-[3-(4-chloro-2-fluorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-hydroxyethanone. InChIKey: IGGNAIYXGIUMQZ-UHFFFAOYSA-N.
| Molecular formula | C20H19ClFN5O2 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | 1-[4-[3-(4-chloro-2-fluorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-hydroxyethanone |
| InChIKey | IGGNAIYXGIUMQZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=C(C(=NN2)C3=C(C=C(C=C3)Cl)F)C4=NC=NC=C4)C(=O)CO |
Computed by PubChem (NCBI)