CAS 63589-22-0 is the registry number for H-Resorcinol Disodium salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Disodium;4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonate (CAS 63589-22-0) is a chemical compound with the molecular formula C16H10N2Na2O9S2 and a molecular weight of 484.4 g/mol. IUPAC name: disodium;4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonate. InChIKey: KBLGETIFHKVSQU-UHFFFAOYSA-L.
| Molecular formula | C16H10N2Na2O9S2 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | disodium;4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonate |
| InChIKey | KBLGETIFHKVSQU-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1O)O)N=NC2=C3C(=CC(=C2)S(=O)(=O)[O-])C=C(C=C3O)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)