Products 63589-51-5
CAS 63589-51-5 is the registry number for Tubulin inhibitor 48. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-diethyl-2-imino-3-(1-methylbenzimidazol-2-yl)chromen-7-amine (CAS 63589-51-5) is a chemical compound with the molecular formula C21H22N4O and a molecular weight of 346.4 g/mol. IUPAC name: N,N-diethyl-2-imino-3-(1-methylbenzimidazol-2-yl)chromen-7-amine. InChIKey: IYMSWNCGOQHQBS-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | N,N-diethyl-2-imino-3-(1-methylbenzimidazol-2-yl)chromen-7-amine |
| InChIKey | IYMSWNCGOQHQBS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=N)O2)C3=NC4=CC=CC=C4N3C |
Computed by PubChem (NCBI)
Synonyms:
Tubulin inhibitor 48, orb2814665