CAS 6359-82-6 appears in our catalog under these names: Acid Yellow 11, ACID YELLOW 11. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 5mg, 100g, 25g, 500g, 250mg, 100mg, 500mg, 1000mg.
Sodium 4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate (CAS 6359-82-6) is a chemical compound with the molecular formula C16H13N4NaO4S and a molecular weight of 380.4 g/mol. IUPAC name: sodium 4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate. InChIKey: UDTJJVCMRRCRDB-UHFFFAOYSA-M.
| Molecular formula | C16H13N4NaO4S |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | sodium 4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate |
| InChIKey | UDTJJVCMRRCRDB-UHFFFAOYSA-M |
| SMILES | CC1=NN(C(=O)C1N=NC2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)