Products 6359-83-7
CAS 6359-83-7 is the registry number for C.I. Mordant yellow 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;2-[[3-methyl-5-oxo-1-(4-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzoate (CAS 6359-83-7) is a chemical compound with the molecular formula C17H12N4Na2O6S and a molecular weight of 446.3 g/mol. IUPAC name: disodium;2-[[3-methyl-5-oxo-1-(4-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzoate. InChIKey: RTBLVNSNIFUUFC-UHFFFAOYSA-L.
| Molecular formula | C17H12N4Na2O6S |
|---|---|
| Molecular weight | 446.3 g/mol |
| IUPAC name | disodium;2-[[3-methyl-5-oxo-1-(4-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzoate |
| InChIKey | RTBLVNSNIFUUFC-UHFFFAOYSA-L |
| SMILES | CC1=NN(C(=O)C1N=NC2=CC=CC=C2C(=O)[O-])C3=CC=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)