CAS 63612-49-7 is the registry number for Nilutamide Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-imino-4,4-dimethyl-1-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidin-2-one (CAS 63612-49-7) is a chemical compound with the molecular formula C12H11F3N4O3 and a molecular weight of 316.24 g/mol. IUPAC name: 5-imino-4,4-dimethyl-1-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidin-2-one. InChIKey: HIIVFEJATHLJHA-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N4O3 |
|---|---|
| Molecular weight | 316.24 g/mol |
| IUPAC name | 5-imino-4,4-dimethyl-1-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| InChIKey | HIIVFEJATHLJHA-UHFFFAOYSA-N |
| SMILES | CC1(C(=N)N(C(=O)N1)C2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)C |
Computed by PubChem (NCBI)