CAS 63638-90-4 is the registry number for Brofaromine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(7-bromo-5-methoxy-1-benzofuran-2-yl)piperidine;hydrochloride (CAS 63638-90-4) is a chemical compound with the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. IUPAC name: 4-(7-bromo-5-methoxy-1-benzofuran-2-yl)piperidine;hydrochloride. InChIKey: PUYKEOGYPYITCW-UHFFFAOYSA-N.
| Molecular formula | C14H17BrClNO2 |
|---|---|
| Molecular weight | 346.65 g/mol |
| IUPAC name | 4-(7-bromo-5-methoxy-1-benzofuran-2-yl)piperidine;hydrochloride |
| InChIKey | PUYKEOGYPYITCW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=C(O2)C3CCNCC3)Br.Cl |
Computed by PubChem (NCBI)