CAS 63645-18-1 appears in our catalog under these names: 4-Chloro-1,1-diphenylbutan-1-ol, 4-Chloro-1,1-diphenylbutan-1-ol, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
4-chloro-1,1-diphenylbutan-1-ol (CAS 63645-18-1) is a chemical compound with the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. IUPAC name: 4-chloro-1,1-diphenylbutan-1-ol. InChIKey: YGSAARYDQXFRKR-UHFFFAOYSA-N.
| Molecular formula | C16H17ClO |
|---|---|
| Molecular weight | 260.76 g/mol |
| IUPAC name | 4-chloro-1,1-diphenylbutan-1-ol |
| InChIKey | YGSAARYDQXFRKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCCCl)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)