CAS 63647-64-3 appears in our catalog under these names: 4-Trifluoromethanesulfonylbenzene-1-sulfonyl chloride, 95%, 4-((Trifluoromethyl)sulfonyl)benzenesulfonyl chloride, 97%, 4-Trifluoromethanesulfonylbenzene-1-sulfonyl chloride, 4-[(TRIFLUOROMETHYL)SULFONYL]BENZENESUL&. Offered by: Combi-blocks, AmBeed, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-(trifluoromethylsulfonyl)benzenesulfonyl chloride (CAS 63647-64-3) is a chemical compound with the molecular formula C7H4ClF3O4S2 and a molecular weight of 308.7 g/mol. IUPAC name: 4-(trifluoromethylsulfonyl)benzenesulfonyl chloride. InChIKey: PGNBXFXYMQFHLQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O4S2 |
|---|---|
| Molecular weight | 308.7 g/mol |
| IUPAC name | 4-(trifluoromethylsulfonyl)benzenesulfonyl chloride |
| InChIKey | PGNBXFXYMQFHLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)