CAS 6367-75-5 appears in our catalog under these names: N,O-Ditosylethanolamine, 95-<97%, 2-(4-METHYLPHENYLSULFONAMIDO)ETHYL 4-METHYLBENZENESULFONATE, 95%, 95%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2-[(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate (CAS 6367-75-5) is a chemical compound with the molecular formula C16H19NO5S2 and a molecular weight of 369.5 g/mol. IUPAC name: 2-[(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate. InChIKey: YHGAZMXLQPXRHA-UHFFFAOYSA-N.
| Molecular formula | C16H19NO5S2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 2-[(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate |
| InChIKey | YHGAZMXLQPXRHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)