CAS 63675-87-6 appears in our catalog under these names: (6-Methoxy-2-(4-methoxyphenyl)benzo(b)thien-3-yl)(4-methoxyphenyl)methanone, LY88074 Trimethyl ether. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 250 mg, 50 mg, 10 mg.
[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone (CAS 63675-87-6) is a chemical compound with the molecular formula C24H20O4S and a molecular weight of 404.5 g/mol. IUPAC name: [6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone. InChIKey: RFSCQXPHEFFAAZ-UHFFFAOYSA-N.
| Molecular formula | C24H20O4S |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | [6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone |
| InChIKey | RFSCQXPHEFFAAZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C3=C(S2)C=C(C=C3)OC)C(=O)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)