CAS 63675-88-7 appears in our catalog under these names: (6-Hydroxy-2-(4-hydroxyphenyl)benzo(b)thien-3-yl)(4-methoxyphenyl)methanone (>80%), LY88074 Methyl ether, LY88074 methyl ether. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 50 mg, 25 mg, 10 mg.
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone (CAS 63675-88-7) is a chemical compound with the molecular formula C22H16O4S and a molecular weight of 376.4 g/mol. IUPAC name: [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone. InChIKey: PYIMIJKXPOXOFJ-UHFFFAOYSA-N.
| Molecular formula | C22H16O4S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone |
| InChIKey | PYIMIJKXPOXOFJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(SC3=C2C=CC(=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)