CAS 63693-13-0 is the registry number for 2-(2,2,2-Trifluoro-1-(trifluoromethyl)ethoxy)ethanol. Offered by: TRC. Available pack sizes: 1g.
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol (CAS 63693-13-0) is a chemical compound with the molecular formula C5H6F6O2 and a molecular weight of 212.09 g/mol. IUPAC name: 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol. InChIKey: HBEFIVLAGLFQET-UHFFFAOYSA-N.
| Molecular formula | C5H6F6O2 |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol |
| InChIKey | HBEFIVLAGLFQET-UHFFFAOYSA-N |
| SMILES | C(COC(C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)