CAS 63697-61-0 appears in our catalog under these names: N3-Tempo, 95%, 4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy, N3–TEMPO, N3-TEMPO, N3-TEMPO 98%. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 10mg, 25mg, 5mg, 50mg, 500mg.
CAS 63697-61-0 identifies a chemical compound with the molecular formula C9H17N4O and a molecular weight of 197.26 g/mol. InChIKey: HFUMVJSTAKNMEX-UHFFFAOYSA-N.
| Molecular formula | C9H17N4O |
|---|---|
| Molecular weight | 197.26 g/mol |
| InChIKey | HFUMVJSTAKNMEX-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1[O])(C)C)N=[N+]=[N-])C |
Computed by PubChem (NCBI)