CAS 637026-02-9 is the registry number for Acetyl Citalopram Oxalate. Offered by: TRC. Available pack sizes: 1g.
1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]ethanone;oxalic acid (CAS 637026-02-9) is a chemical compound with the molecular formula C23H26FNO6 and a molecular weight of 431.5 g/mol. IUPAC name: 1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]ethanone;oxalic acid. InChIKey: AMKLHBUGFZIUMQ-UHFFFAOYSA-N.
| Molecular formula | C23H26FNO6 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | 1-[1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]ethanone;oxalic acid |
| InChIKey | AMKLHBUGFZIUMQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C(OC2)(CCCN(C)C)C3=CC=C(C=C3)F.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)