CAS 63717-35-1 is the registry number for Bis(8-quinolinyl 1-hydroxy-2-naphthalenecarboxylato-O1,O2')copper, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(3-quinolin-8-yloxycarbonylnaphthalen-1-olate) (CAS 63717-35-1) is a chemical compound with the molecular formula C40H24CuN2O6 and a molecular weight of 692.2 g/mol. IUPAC name: copper bis(3-quinolin-8-yloxycarbonylnaphthalen-1-olate). InChIKey: GIQVGBDGYSGPFF-UHFFFAOYSA-L.
| Molecular formula | C40H24CuN2O6 |
|---|---|
| Molecular weight | 692.2 g/mol |
| IUPAC name | copper bis(3-quinolin-8-yloxycarbonylnaphthalen-1-olate) |
| InChIKey | GIQVGBDGYSGPFF-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2[O-])C(=O)OC3=CC=CC4=C3N=CC=C4.C1=CC=C2C(=C1)C=C(C=C2[O-])C(=O)OC3=CC=CC4=C3N=CC=C4.[Cu+2] |
Computed by PubChem (NCBI)