Products 63720-83-2

CAS 63720-83-2 is the registry number for Zotepine N-Oxide, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide (CAS 63720-83-2) is a chemical compound with the molecular formula C18H18ClNO2S and a molecular weight of 347.9 g/mol. IUPAC name: 2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide. InChIKey: IZIOJMRQCYPVQW-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18ClNO2S
Molecular weight347.9 g/mol
IUPAC name2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide
InChIKeyIZIOJMRQCYPVQW-UHFFFAOYSA-N
SMILESC[N+](C)(CCOC1=CC2=CC=CC=C2SC3=C1C=C(C=C3)Cl)[O-]

Computed by PubChem (NCBI)