CAS 63720-83-2 is the registry number for Zotepine N-Oxide, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide (CAS 63720-83-2) is a chemical compound with the molecular formula C18H18ClNO2S and a molecular weight of 347.9 g/mol. IUPAC name: 2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide. InChIKey: IZIOJMRQCYPVQW-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO2S |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | 2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxy-N,N-dimethylethanamine oxide |
| InChIKey | IZIOJMRQCYPVQW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCOC1=CC2=CC=CC=C2SC3=C1C=C(C=C3)Cl)[O-] |
Computed by PubChem (NCBI)