CAS 63721-06-2 appears in our catalog under these names: Nh-bis(peg4-oh), 95%, NH–bis–PEG5, NH-bis(peg4-oh) 98%, NH-bis(PEG4-OH), 98%, 98%, NH-bis-PEG5. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50 mg, 1 g, 100 mg, 250 mg, 25 mg.
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 63721-06-2) is a chemical compound with the molecular formula C20H43NO10 and a molecular weight of 457.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: IDUORIHIPQGGGX-UHFFFAOYSA-N.
| Molecular formula | C20H43NO10 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | IDUORIHIPQGGGX-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCO)NCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)