CAS 63721-14-2 appears in our catalog under these names: Ho-apeg8-oh, 95%, NH–bis–PEG4, HO-apeg8-oh 95%, HO-apeg8-oh, 95%, 95%, NH-bis-PEG4, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 50 mg, 100 mg, 500 mg.
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethanol (CAS 63721-14-2) is a chemical compound with the molecular formula C16H35NO8 and a molecular weight of 369.45 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: MTDAOFBRUZCGHZ-UHFFFAOYSA-N.
| Molecular formula | C16H35NO8 |
|---|---|
| Molecular weight | 369.45 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | MTDAOFBRUZCGHZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCO)NCCOCCOCCOCCO |
Computed by PubChem (NCBI)