CAS 6373-95-1 is the registry number for 4'-Diethylamino-2-methoxy-4-nitroazobenzene, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
N,N-diethyl-4-[(2-methoxy-4-nitrophenyl)diazenyl]aniline (CAS 6373-95-1) is a chemical compound with the molecular formula C17H20N4O3 and a molecular weight of 328.4 g/mol. IUPAC name: N,N-diethyl-4-[(2-methoxy-4-nitrophenyl)diazenyl]aniline. InChIKey: SXHUBOLNSOIMCA-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | N,N-diethyl-4-[(2-methoxy-4-nitrophenyl)diazenyl]aniline |
| InChIKey | SXHUBOLNSOIMCA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)