CAS 637302-91-1 is the registry number for 4,6-Dibromo-2-(2-bromophenyl)benzo[d]oxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dibromo-2-(2-bromophenyl)-1,3-benzoxazol-5-amine (CAS 637302-91-1) is a chemical compound with the molecular formula C13H7Br3N2O and a molecular weight of 446.92 g/mol. IUPAC name: 4,6-dibromo-2-(2-bromophenyl)-1,3-benzoxazol-5-amine. InChIKey: CUDLRNYZNURNKN-UHFFFAOYSA-N.
| Molecular formula | C13H7Br3N2O |
|---|---|
| Molecular weight | 446.92 g/mol |
| IUPAC name | 4,6-dibromo-2-(2-bromophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | CUDLRNYZNURNKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(C(=C(C=C3O2)Br)N)Br)Br |
Computed by PubChem (NCBI)