CAS 637303-13-0 is the registry number for 4,6-Dibromo-2-(3,4-dichlorophenyl)benzo[d]oxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dibromo-2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine (CAS 637303-13-0) is a chemical compound with the molecular formula C13H6Br2Cl2N2O and a molecular weight of 436.9 g/mol. IUPAC name: 4,6-dibromo-2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine. InChIKey: KQUISUNPPYVJDD-UHFFFAOYSA-N.
| Molecular formula | C13H6Br2Cl2N2O |
|---|---|
| Molecular weight | 436.9 g/mol |
| IUPAC name | 4,6-dibromo-2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | KQUISUNPPYVJDD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC3=C(C(=C(C=C3O2)Br)N)Br)Cl)Cl |
Computed by PubChem (NCBI)