CAS 63755-07-7 appears in our catalog under these names: 2,2'-Disulfanediylbis(4-fluoroaniline), 95%, 95%, 2,2'-Disulfanediylbis(4-fluoroaniline), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-[(2-amino-5-fluorophenyl)disulfanyl]-4-fluoroaniline (CAS 63755-07-7) is a chemical compound with the molecular formula C12H10F2N2S2 and a molecular weight of 284.4 g/mol. IUPAC name: 2-[(2-amino-5-fluorophenyl)disulfanyl]-4-fluoroaniline. InChIKey: FXPLBZOROWJUBV-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2S2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 2-[(2-amino-5-fluorophenyl)disulfanyl]-4-fluoroaniline |
| InChIKey | FXPLBZOROWJUBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)SSC2=C(C=CC(=C2)F)N)N |
Computed by PubChem (NCBI)