CAS 63755-08-8 appears in our catalog under these names: 6,6'-disulfanediylbis(2-chloroaniline), Ticagrelor Impurity 72. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-amino-3-chlorophenyl)disulfanyl]-6-chloroaniline (CAS 63755-08-8) is a chemical compound with the molecular formula C12H10Cl2N2S2 and a molecular weight of 317.3 g/mol. IUPAC name: 2-[(2-amino-3-chlorophenyl)disulfanyl]-6-chloroaniline. InChIKey: GDCMDAOKWQFPDX-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2S2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 2-[(2-amino-3-chlorophenyl)disulfanyl]-6-chloroaniline |
| InChIKey | GDCMDAOKWQFPDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)SSC2=C(C(=CC=C2)Cl)N |
Computed by PubChem (NCBI)