CAS 637753-85-6 is the registry number for (2Z)-2-(2-Chloro-6-fluorobenzylidene)-6-hydroxy-1-benzofuran-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (CAS 637753-85-6) is a chemical compound with the molecular formula C15H8ClFO3 and a molecular weight of 290.67 g/mol. IUPAC name: (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one. InChIKey: CYXLDICAQDGQHC-AUWJEWJLSA-N.
| Molecular formula | C15H8ClFO3 |
|---|---|
| Molecular weight | 290.67 g/mol |
| IUPAC name | (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| InChIKey | CYXLDICAQDGQHC-AUWJEWJLSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C\2/C(=O)C3=C(O2)C=C(C=C3)O)F |
Computed by PubChem (NCBI)