CAS 63777-70-8 appears in our catalog under these names: 2-Chlorobenzyl Azide, 1-(Azidomethyl)-2-chlorobenzene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10g.
1-(azidomethyl)-2-chlorobenzene (CAS 63777-70-8) is a chemical compound with the molecular formula C7H6ClN3 and a molecular weight of 167.59 g/mol. IUPAC name: 1-(azidomethyl)-2-chlorobenzene. InChIKey: BOSNISRGGXSMHE-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3 |
|---|---|
| Molecular weight | 167.59 g/mol |
| IUPAC name | 1-(azidomethyl)-2-chlorobenzene |
| InChIKey | BOSNISRGGXSMHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN=[N+]=[N-])Cl |
Computed by PubChem (NCBI)