CAS 638-38-0 appears in our catalog under these names: Manganese(ii) acetate, 95%, Manganese(II) acetate, 99% (contains <1%H2O), Manganese acetate, Manganese(II) acetate, anhydrous, 98+% , Manganese(II) Acetate, >98.0%(T). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 1000g, 50g, 250g.
Manganese(2+) diacetate (CAS 638-38-0) is a chemical compound with the molecular formula C4H6MnO4 and a molecular weight of 173.03 g/mol. IUPAC name: manganese(2+) diacetate. InChIKey: UOGMEBQRZBEZQT-UHFFFAOYSA-L.
| Molecular formula | C4H6MnO4 |
|---|---|
| Molecular weight | 173.03 g/mol |
| IUPAC name | manganese(2+) diacetate |
| InChIKey | UOGMEBQRZBEZQT-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Mn+2] |
Computed by PubChem (NCBI)