Products 63818-94-0

CAS 63818-94-0 is the registry number for (R)-2-Fluoro-2-phenylacetic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-2-fluoro-2-phenylacetic acid (CAS 63818-94-0) is a chemical compound with the molecular formula C8H7FO2 and a molecular weight of 154.14 g/mol. IUPAC name: (2R)-2-fluoro-2-phenylacetic acid. InChIKey: ATPPNMLQNZHDOG-SSDOTTSWSA-N.

Identity
Molecular formulaC8H7FO2
Molecular weight154.14 g/mol
IUPAC name(2R)-2-fluoro-2-phenylacetic acid
InChIKeyATPPNMLQNZHDOG-SSDOTTSWSA-N
SMILESC1=CC=C(C=C1)[C@H](C(=O)O)F

Computed by PubChem (NCBI)