CAS 6385-58-6 appears in our catalog under these names: 2,2'-Thiobis(4,6-dichlorophenol) disodium salt, 95%, Sodium 6,6'-thiobis(2,4-dichlorophenolate), 98%, 2,2'–Thiobis(4,6–dichlorophenol) Disodium Salt, Bithionol Disodium Salt, >98.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 25g, 1g, 5g.
Disodium;2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate (CAS 6385-58-6) is a chemical compound with the molecular formula C12H4Cl4Na2O2S and a molecular weight of 400.0 g/mol. IUPAC name: disodium;2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate. InChIKey: FNYZFZRGBBCWBI-UHFFFAOYSA-L.
| Molecular formula | C12H4Cl4Na2O2S |
|---|---|
| Molecular weight | 400.0 g/mol |
| IUPAC name | disodium;2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate |
| InChIKey | FNYZFZRGBBCWBI-UHFFFAOYSA-L |
| SMILES | C1=C(C=C(C(=C1SC2=C(C(=CC(=C2)Cl)Cl)[O-])[O-])Cl)Cl.[Na+].[Na+] |
Computed by PubChem (NCBI)