CAS 63857-90-9 appears in our catalog under these names: 4,5-Dicyano-2-(2-methylphenyl)imidazole, 95%, 2-(o-Tolyl)-1H-imidazole-4,5-dicarbonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(2-methylphenyl)-1H-imidazole-4,5-dicarbonitrile (CAS 63857-90-9) is a chemical compound with the molecular formula C12H8N4 and a molecular weight of 208.22 g/mol. IUPAC name: 2-(2-methylphenyl)-1H-imidazole-4,5-dicarbonitrile. InChIKey: NQLCQVAWPMBQAB-UHFFFAOYSA-N.
| Molecular formula | C12H8N4 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 2-(2-methylphenyl)-1H-imidazole-4,5-dicarbonitrile |
| InChIKey | NQLCQVAWPMBQAB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC(=C(N2)C#N)C#N |
Computed by PubChem (NCBI)