CAS 63870-44-0 is the registry number for 2,2'-Diselanediyldianiline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-aminophenyl)diselanyl]aniline (CAS 63870-44-0) is a chemical compound with the molecular formula C12H12N2Se2 and a molecular weight of 342.2 g/mol. IUPAC name: 2-[(2-aminophenyl)diselanyl]aniline. InChIKey: CTCGHLVDQKKOCB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2Se2 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 2-[(2-aminophenyl)diselanyl]aniline |
| InChIKey | CTCGHLVDQKKOCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)[Se][Se]C2=CC=CC=C2N |
Computed by PubChem (NCBI)