CAS 63891-99-6 appears in our catalog under these names: 2-(4-Chloro-2-methylphenoxy)-2-phenylacetic acid, 95%, 2-(4-Chloro-2-methylphenoxy)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(4-chloro-2-methylphenoxy)-2-phenylacetic acid (CAS 63891-99-6) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-2-phenylacetic acid. InChIKey: YNXFAEHDDVUDKC-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenoxy)-2-phenylacetic acid |
| InChIKey | YNXFAEHDDVUDKC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)