CAS 63922-84-9 appears in our catalog under these names: (2-Trimethylsilylethyl)triphenylphosphonium iodide, 95%, Triphenyl(2-(trimethylsilyl)ethyl)phosphonium iodide, 95+%, Triphenyl(2–(trimethylsilyl)ethyl)phosphonium iodide, (2-Trimethylsilylethyl)triphenylphosphonium Iodide, >98.0%(HPLC)(T), Triphenyl(2-(trimethylsilyl)ethyl)phosphonium iodide, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 200mg.
Triphenyl(2-trimethylsilylethyl)phosphanium iodide (CAS 63922-84-9) is a chemical compound with the molecular formula C23H28IPSi and a molecular weight of 490.4 g/mol. IUPAC name: triphenyl(2-trimethylsilylethyl)phosphanium iodide. InChIKey: NXZYPOSEOPBJMW-UHFFFAOYSA-M.
| Molecular formula | C23H28IPSi |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | triphenyl(2-trimethylsilylethyl)phosphanium iodide |
| InChIKey | NXZYPOSEOPBJMW-UHFFFAOYSA-M |
| SMILES | C[Si](C)(C)CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
Computed by PubChem (NCBI)