CAS 63931-21-5 appears in our catalog under these names: 5–Bromo–2,4,6–trichloropyrimidine, 5-Bromo-2,4,6-trichloropyrimidine, 97%, 5-Bromo-2,4,6-trichloropyrimidine, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
5-bromo-2,4,6-trichloropyrimidine (CAS 63931-21-5) is a chemical compound with the molecular formula C4BrCl3N2 and a molecular weight of 262.31 g/mol. IUPAC name: 5-bromo-2,4,6-trichloropyrimidine. InChIKey: GKTWIIVEUYLSCS-UHFFFAOYSA-N.
| Molecular formula | C4BrCl3N2 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 5-bromo-2,4,6-trichloropyrimidine |
| InChIKey | GKTWIIVEUYLSCS-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)Cl)Cl)Br |
Computed by PubChem (NCBI)