CAS 63938-63-6 appears in our catalog under these names: N,N-Diethyltryptamine Hydrochloride, >95% (HPLC), N,N–DET (hydrochloride). Offered by: TRC, GLPBio. Available pack sizes: 10mg, 2,5mg, 25mg, 1mg, 5mg.
Diethyl-[2-(1H-indol-3-yl)ethyl]azanium chloride (CAS 63938-63-6) is a chemical compound with the molecular formula C14H21ClN2 and a molecular weight of 252.78 g/mol. IUPAC name: diethyl-[2-(1H-indol-3-yl)ethyl]azanium chloride. InChIKey: GHDJWZZXXNZUST-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2 |
|---|---|
| Molecular weight | 252.78 g/mol |
| IUPAC name | diethyl-[2-(1H-indol-3-yl)ethyl]azanium chloride |
| InChIKey | GHDJWZZXXNZUST-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CCC1=CNC2=CC=CC=C21.[Cl-] |
Computed by PubChem (NCBI)