Products 63958-77-0
CAS 63958-77-0 appears in our catalog under these names: (–)–7–nor–7–carboxy Cannabidiol, 7-Carboxycannabidiol, (-)-7-Nor-7-carboxy cannabidiol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 2mg, 25mg, 500 μg, 1 mg.
(3R,4R)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid (CAS 63958-77-0) is a chemical compound with the molecular formula C21H28O4 and a molecular weight of 344.4 g/mol. IUPAC name: (3R,4R)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid. InChIKey: LQHAPFLIUQWVJR-DLBZAZTESA-N.
| Molecular formula | C21H28O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (3R,4R)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid |
| InChIKey | LQHAPFLIUQWVJR-DLBZAZTESA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C(=O)O)O |
Computed by PubChem (NCBI)