Products 63976-69-2
CAS 63976-69-2 appears in our catalog under these names: 13-Oxopodocarp-8(14)-en-18-oic acid, 13-Keto-8(14)-Podocarpen-18-oic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-oxo-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid (CAS 63976-69-2) is a chemical compound with the molecular formula C17H24O3 and a molecular weight of 276.4 g/mol. IUPAC name: (1R,4aR,4bS,10aR)-1,4a-dimethyl-7-oxo-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid. InChIKey: DXXGHDAWCPTRPU-XOSAIJSUSA-N.
| Molecular formula | C17H24O3 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | (1R,4aR,4bS,10aR)-1,4a-dimethyl-7-oxo-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
| InChIKey | DXXGHDAWCPTRPU-XOSAIJSUSA-N |
| SMILES | C[C@]12CCC[C@@]([C@@H]1CCC3=CC(=O)CC[C@H]23)(C)C(=O)O |
Computed by PubChem (NCBI)