CAS 63987-04-2 is the registry number for 5-Hydroxynitrofen. Offered by: TRC. Available pack sizes: 500mg, 5g.
2,4-dichloro-5-(4-nitrophenoxy)phenol (CAS 63987-04-2) is a chemical compound with the molecular formula C12H7Cl2NO4 and a molecular weight of 300.09 g/mol. IUPAC name: 2,4-dichloro-5-(4-nitrophenoxy)phenol. InChIKey: WDVAZDOELNWYFI-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO4 |
|---|---|
| Molecular weight | 300.09 g/mol |
| IUPAC name | 2,4-dichloro-5-(4-nitrophenoxy)phenol |
| InChIKey | WDVAZDOELNWYFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=C(C=C(C(=C2)O)Cl)Cl |
Computed by PubChem (NCBI)