CAS 6400-97-1 appears in our catalog under these names: 3-Pentanone-2,2,4,4-d4, 98 atom % D, min 98% Chemical Purity, 3–PENTANONE–2,2,4,4–D4. Offered by: CDN, GLPBio. Available pack sizes: 1g, 100mg.
2,2,4,4-tetradeuteriopentan-3-one (CAS 6400-97-1) is a chemical compound with the molecular formula C5H10O and a molecular weight of 90.16 g/mol. IUPAC name: 2,2,4,4-tetradeuteriopentan-3-one. InChIKey: FDPIMTJIUBPUKL-KHORGVISSA-N.
| Molecular formula | C5H10O |
|---|---|
| Molecular weight | 90.16 g/mol |
| IUPAC name | 2,2,4,4-tetradeuteriopentan-3-one |
| InChIKey | FDPIMTJIUBPUKL-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C)C(=O)C([2H])([2H])C |
Computed by PubChem (NCBI)