CAS 64018-22-0 appears in our catalog under these names: 3,3'-(Phenylphosphinediyl)dibenzenesulfonic acid, disodium salt, 98%, 98%, 3,3'-(Phenylphosphinediyl)dibenzenesulfonic acid, disodium salt, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Disodium;3-[phenyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate (CAS 64018-22-0) is a chemical compound with the molecular formula C18H13Na2O6PS2 and a molecular weight of 466.4 g/mol. IUPAC name: disodium;3-[phenyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate. InChIKey: PWRPHTBBQPNXQA-UHFFFAOYSA-L.
| Molecular formula | C18H13Na2O6PS2 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | disodium;3-[phenyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate |
| InChIKey | PWRPHTBBQPNXQA-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC(=CC=C2)S(=O)(=O)[O-])C3=CC(=CC=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)