CAS 6402-02-4 is the registry number for 5-Bromoindolin-3-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1,2-dihydroindol-3-one (CAS 6402-02-4) is a chemical compound with the molecular formula C8H6BrNO and a molecular weight of 212.04 g/mol. IUPAC name: 5-bromo-1,2-dihydroindol-3-one. InChIKey: VGYNCASKYPVXGI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO |
|---|---|
| Molecular weight | 212.04 g/mol |
| IUPAC name | 5-bromo-1,2-dihydroindol-3-one |
| InChIKey | VGYNCASKYPVXGI-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)