CAS 640263-69-0 is the registry number for (3-Amino-4-pyrrolidin-1-yl-phenyl)-pyrrolidin-1-yl-methanone, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 2g.
(3-amino-4-pyrrolidin-1-ylphenyl)-pyrrolidin-1-ylmethanone (CAS 640263-69-0) is a chemical compound with the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. IUPAC name: (3-amino-4-pyrrolidin-1-ylphenyl)-pyrrolidin-1-ylmethanone. InChIKey: JTDXKOHITSIIRS-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O |
|---|---|
| Molecular weight | 259.35 g/mol |
| IUPAC name | (3-amino-4-pyrrolidin-1-ylphenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | JTDXKOHITSIIRS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)C(=O)N3CCCC3)N |
Computed by PubChem (NCBI)