Products 640263-95-2
CAS 640263-95-2 is the registry number for Epoxykynin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-cycloheptylacetamide (CAS 640263-95-2) is a chemical compound with the molecular formula C19H20BrF3N2O2 and a molecular weight of 445.3 g/mol. IUPAC name: 2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-cycloheptylacetamide. InChIKey: LJWGWJLCHFYATI-UHFFFAOYSA-N.
| Molecular formula | C19H20BrF3N2O2 |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | 2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-cycloheptylacetamide |
| InChIKey | LJWGWJLCHFYATI-UHFFFAOYSA-N |
| SMILES | C1CCCC(CC1)NC(=O)CN2C=C(C3=C2C=CC(=C3)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)