CAS 640297-84-3 appears in our catalog under these names: 3,8–Diethynyl–1,10–phenanthroline, 3,8-Diethynyl-1,10-phenanthroline 98%, 3,8-Diethynyl-1,10-phenanthroline, 98%, 98%, 3,8-Diethynyl-1,10-phenanthroline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
3,8-diethynyl-1,10-phenanthroline (CAS 640297-84-3) is a chemical compound with the molecular formula C16H8N2 and a molecular weight of 228.25 g/mol. IUPAC name: 3,8-diethynyl-1,10-phenanthroline. InChIKey: ZCPVSKKKVVMMPV-UHFFFAOYSA-N.
| Molecular formula | C16H8N2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 3,8-diethynyl-1,10-phenanthroline |
| InChIKey | ZCPVSKKKVVMMPV-UHFFFAOYSA-N |
| SMILES | C#CC1=CN=C2C(=C1)C=CC3=CC(=CN=C32)C#C |
Computed by PubChem (NCBI)