CAS 6404-31-5 appears in our catalog under these names: Z–D–Pro–OH, Z-D-Pro-OH, N-Carbobenzoxy-D-proline, >98.0%(HPLC)(T), Cbz-D-Pro-OH 97%, Z-D-Pro-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 250g, 5g, 500g, 1000g, 10g, 1kg.
(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 6404-31-5) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: (2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: JXGVXCZADZNAMJ-LLVKDONJSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | (2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | JXGVXCZADZNAMJ-LLVKDONJSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)